1-(5-Bromo-2-methoxy-phenyl)adamantane

• CAS: 104224-63-7
• Catalog Number: ACM104224637
• Category: Bromine Series
• Molecular Weight: 321.25
• Molecular Formula: C₁₇H₂₁BrO

Custom Q&A

What is the molecular formula of the compound?

The molecular formula of the compound is C17H21BrO.

What is the molecular weight of the compound?

The molecular weight of the compound is 321.3 g/mol.

What is the IUPAC name of the compound?

The IUPAC name of the compound is 1-(5-bromo-2-methoxyphenyl)adamantane.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C17H21BrO/c1-19-16-3-2-14(18)7-15(16)17-8-11-4-12(9-17)6-13(5-11)10-17/h2-3,7,11-13H,4-6,8-10H2,1H3.

What is the InChIKey of the compound?

The InChIKey of the compound is QQAMHHZQONQBFZ-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES of the compound is COC1=C(C=C(C=C1)Br)C23CC4CC(C2)CC(C4)C3.

What is the CAS number of the compound?

The CAS number of the compound is 104224-63-7.

What is the EC number of the compound?

The EC number of the compound is 926-283-9.

What is the DSSTox Substance ID of the compound?

The DSSTox Substance ID of the compound is DTXSID30391054.

Is the compound canonicalized?

Yes, the compound is canonicalized.