CAS
920492-33-7 Purity
---
920492-33-7 Purity
---
Shopping basket
1-(4-fluorophenyl)cyclobutanamine hydrochloride
CAS
920501-69-5
Catalog Number
ACM920501695
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of the compound?
The molecular formula of the compound is C10H13ClFN.
What is the molecular weight of the compound?
The molecular weight of the compound is 201.67 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 1-(4-fluorophenyl)cyclobutan-1-amine hydrochloride.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C10H12FN.ClH/c11-9-4-2-8(3-5-9)10(12)6-1-7-10;/h2-5H,1,6-7,12H2;1H.
What is the InChIKey of the compound?
The InChIKey of the compound is UHGWAVIHBAZSMM-UHFFFAOYSA-N.
What is the Canonical SMILES of the compound?
The Canonical SMILES of the compound is C1CC(C1)(C2=CC=C(C=C2)F)N.Cl.
What is the hydrogen bond donor count of the compound?
The hydrogen bond donor count of the compound is 2.
What is the hydrogen bond acceptor count of the compound?
The hydrogen bond acceptor count of the compound is 2.
How many rotatable bonds does the compound have?
The compound has 1 rotatable bond.
What is the topological polar surface area of the compound?
The topological polar surface area of the compound is 26.2.
Recommended Products
