1,2-Bis(methyldiethoxysilyl)ethane

• Catalog Number: ACM88736805
• Product Name: 1,2-Bis(methyldiethoxysilyl)ethane
• CAS: 88736-80-5
• Category: Siloxanes
• IUPAC Name: 2-[diethoxy(methyl)silyl]ethyl-diethoxy-methylsilane
• Molecular Weight: 294.54
• Molecular Formula: C₁₂H₃₀O₄Si₂
• Canonical SMILES: CCO[Si](C)(CC[Si](C)(OCC)OCC)OCC
• InChI Key: HITBDIPWYKTHIH-UHFFFAOYSA-N
• Appearance: Transparent liquid
• EC Number: 241-953-4
• Exact Mass: 294.16800

Custom Q&A

What is the molecular formula of 1,2-Bis(methyldiethoxysilyl)ethane?

The molecular formula is C12H30O4Si2.

What is the IUPAC name of the compound?

The IUPAC name is 2-[diethoxy(methyl)silyl]ethyl-diethoxy-methylsilane.

What is the InChI of the compound?

The InChI is InChI=1S/C12H30O4Si2/c1-7-13-17(5,14-8-2)11-12-18(6,15-9-3)16-10-4/h7-12H2,1-6H3.

What is the InChIKey of the compound?

The InChIKey is HITBDIPWYKTHIH-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES is CCO[Si](C)(CC[Si](C)(OCC)OCC)OCC.

What is the molecular weight of the compound?

The molecular weight is 294.53 g/mol.

How many hydrogen bond donor counts does the compound have?

The compound has 0 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does the compound have?

The compound has 4 hydrogen bond acceptor counts.

How many rotatable bond counts does the compound have?

The compound has 11 rotatable bond counts.

Is the compound canonicalized?

Yes, the compound is canonicalized.

What are the synonyms of 1,2-Bis(methyldiethoxysilyl)ethane?

The synonyms are 4,7-Diethoxy-4,7-dimethyl-3,8-dioxa-4,7-disiladecane and 2-[diethoxy(methyl)silyl]ethyl-diethoxy-methylsilane.

What is the molecular weight of 1,2-Bis(methyldiethoxysilyl)ethane?

The molecular weight is 294.53 g/mol.

What is the IUPAC name of 1,2-Bis(methyldiethoxysilyl)ethane?

The IUPAC name is 2-[diethoxy(methyl)silyl]ethyl-diethoxy-methylsilane.

What is the InChI of 1,2-Bis(methyldiethoxysilyl)ethane?

The InChI is InChI=1S/C12H30O4Si2/c1-7-13-17(5,14-8-2)11-12-18(6,15-9-3)16-10-4/h7-12H2,1-6H3.

What is the InChIKey of 1,2-Bis(methyldiethoxysilyl)ethane?

The InChIKey is HITBDIPWYKTHIH-UHFFFAOYSA-N.

What is the canonical SMILES of 1,2-Bis(methyldiethoxysilyl)ethane?

The canonical SMILES is CCO[Si](C)(CC[Si](C)(OCC)OCC).

What is the hydrogen bond donor count of 1,2-Bis(methyldiethoxysilyl)ethane?

The hydrogen bond donor count is 0.

What is the hydrogen bond acceptor count of 1,2-Bis(methyldiethoxysilyl)ethane?

The hydrogen bond acceptor count is 4.

Is 1,2-Bis(methyldiethoxysilyl)ethane a canonicalized compound?

Yes, 1,2-Bis(methyldiethoxysilyl)ethane is a canonicalized compound.