What is the molecular formula of 1,12-Dodecanedioic-2,2,11,11-d4 acid?
The molecular formula of 1,12-Dodecanedioic-2,2,11,11-d4 acid is C12H22O4.
What is the molecular weight of 1,12-Dodecanedioic-2,2,11,11-d4 acid?
The molecular weight of 1,12-Dodecanedioic-2,2,11,11-d4 acid is 234.32 g/mol.
When was 1,12-Dodecanedioic-2,2,11,11-d4 acid created?
1,12-Dodecanedioic-2,2,11,11-d4 acid was created on February 16, 2015.
What is the IUPAC name of 1,12-Dodecanedioic-2,2,11,11-d4 acid?
The IUPAC name of 1,12-Dodecanedioic-2,2,11,11-d4 acid is 2,2,11,11-tetradeuteriododecanedioic acid.
What is the InChI code of 1,12-Dodecanedioic-2,2,11,11-d4 acid?
The InChI code of 1,12-Dodecanedioic-2,2,11,11-d4 acid is InChI=1S/C12H22O4/c13-11(14)9-7-5-3-1-2-4-6-8-10-12(15)16/h1-10H2,(H,13,14)(H,15,16)/i9D2,10D2.
What is the InChIKey of 1,12-Dodecanedioic-2,2,11,11-d4 acid?
The InChIKey of 1,12-Dodecanedioic-2,2,11,11-d4 acid is TVIDDXQYHWJXFK-YQUBHJMPSA-N.
What is the canonical SMILES representation of 1,12-Dodecanedioic-2,2,11,11-d4 acid?
The canonical SMILES representation of 1,12-Dodecanedioic-2,2,11,11-d4 acid is C(CCCCCC(=O)O)CCCCC(=O)O.
What is the XLogP3 value of 1,12-Dodecanedioic-2,2,11,11-d4 acid?
The XLogP3 value of 1,12-Dodecanedioic-2,2,11,11-d4 acid is 3.2.
How many rotatable bonds does 1,12-Dodecanedioic-2,2,11,11-d4 acid have?
1,12-Dodecanedioic-2,2,11,11-d4 acid has 11 rotatable bonds.
Is 1,12-Dodecanedioic-2,2,11,11-d4 acid a canonicalized compound?
Yes, 1,12-Dodecanedioic-2,2,11,11-d4 acid is a canonicalized compound.