What is the molecular formula of prednisolone sodium succinate?
The molecular formula of prednisolone sodium succinate is C25H31NaO8.
What is the molecular weight of prednisolone sodium succinate?
The molecular weight of prednisolone sodium succinate is 482.5 g/mol.
What is the IUPAC Name of prednisolone sodium succinate?
The IUPAC Name of prednisolone sodium succinate is sodium;4-[2-[(8S,9S,10R,11S,13S,14S,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethoxy]-4-oxobutanoate.
What is the InChIKey of prednisolone sodium succinate?
The InChIKey of prednisolone sodium succinate is FKKAEMQFOIDZNY-CODXZCKSSA-M.
What is the canonical SMILES of prednisolone sodium succinate?
The canonical SMILES of prednisolone sodium succinate is CC12CC(C3C(C1CCC2(C(=O)COC(=O)CCC(=O)[O-])O)CCC4=CC(=O)C=CC34C).[Na+].
What is the CAS number of prednisolone sodium succinate?
The CAS number of prednisolone sodium succinate is 1715-33-9.
What is the EC number of prednisolone sodium succinate?
The EC number of prednisolone sodium succinate is 216-995-1.
What is the UNII number of prednisolone sodium succinate?
The UNII number of prednisolone sodium succinate is 8223RR9DWF.
What is the ChEMBL ID of prednisolone sodium succinate?
The ChEMBL ID of prednisolone sodium succinate is CHEMBL1412530.
What is the NCI Thesaurus Code of prednisolone sodium succinate?
The NCI Thesaurus Code of prednisolone sodium succinate is C1403.
※ Please kindly note that our products are for research use only.