What is the PubChem CID for prednisolone acetate?
The PubChem CID for prednisolone acetate is 5834.
What is the molecular formula of prednisolone acetate?
The molecular formula of prednisolone acetate is C23H30O6.
What is the molecular weight of prednisolone acetate?
The molecular weight of prednisolone acetate is 402.5 g/mol.
When was prednisolone acetate created?
Prednisolone acetate was created on March 26, 2005.
When was prednisolone acetate last modified?
Prednisolone acetate was last modified on November 25, 2023.
What is the IUPAC name of prednisolone acetate?
The IUPAC name of prednisolone acetate is [2-[(8S,9S,10R,11S,13S,14S,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate.
What is the InChI of prednisolone acetate?
The InChI of prednisolone acetate is InChI=1S/C23H30O6/c1-13(24)29-12-19(27)23(28)9-7-17-16-5-4-14-10-15(25)6-8-21(14,2)20(16)18(26)11-22(17,23)3/h6,8,10,16-18,20,26,28H,4-5,7,9,11-12H2,1-3H3/t16-,17-,18-,20+,21-,22-,23-/m0/s1.
What is the InChIKey of prednisolone acetate?
The InChIKey of prednisolone acetate is LRJOMUJRLNCICJ-JZYPGELDSA-N.
What is the canonical SMILES of prednisolone acetate?
The canonical SMILES of prednisolone acetate is CC(=O)OCC(=O)C1(CCC2C1(CC(C3C2CCC4=CC(=O)C=CC34C)O)C)O.
What is the CAS number of prednisolone acetate?
The CAS number of prednisolone acetate is 52-21-1.