What is the molecular formula of potassium octoate?
The molecular formula of potassium octoate is C8H15KO2.
What are the synonyms for potassium octoate?
The synonyms for potassium octoate are potassium octanoate and potassium caprylate.
What is the molecular weight of potassium octoate?
The molecular weight of potassium octoate is 182.30 g/mol.
What is the parent compound of potassium octoate?
The parent compound of potassium octoate is octanoic acid.
What are the component compounds of potassium octoate?
The component compounds of potassium octoate are octanoic acid and potassium.
What is the IUPAC name of potassium octoate?
The IUPAC name of potassium octoate is potassium;octanoate.
What is the InChI of potassium octoate?
The InChI of potassium octoate is InChI=1S/C8H16O2.K/c1-2-3-4-5-6-7-8(9)10;/h2-7H2,1H3,(H,9,10);/q;+1/p-1.
What is the InChIKey of potassium octoate?
The InChIKey of potassium octoate is RLEFZEWKMQQZOA-UHFFFAOYSA-M.
What is the canonical SMILES of potassium octoate?
The canonical SMILES of potassium octoate is CCCCCCCC(=O)[O-].[K+].
What is the CAS number of potassium octoate?
The CAS number of potassium octoate is 764-71-6.