What is the molecular formula of Potassium 3-formylphenyltrifluoroborate?
The molecular formula is C7H5BF3KO.
What are the synonyms for Potassium 3-formylphenyltrifluoroborate?
The synonyms are Potassium 3-formylphenyltrifluoroborate, 871231-44-6, potassium;trifluoro-(3-formylphenyl)boranuide, and Potassium trifluoro(3-formylphenyl)borate.
What is the molecular weight of Potassium 3-formylphenyltrifluoroborate?
The molecular weight is 212.02 g/mol.
What is the IUPAC name of Potassium 3-formylphenyltrifluoroborate?
The IUPAC name is potassium;trifluoro-(3-formylphenyl)boranuide.
What is the InChI of Potassium 3-formylphenyltrifluoroborate?
The InChI is InChI=1S/C7H5BF3O.K/c9-8(10,11)7-3-1-2-6(4-7)5-12;/h1-5H;/q-1;+1.
What is the InChIKey of Potassium 3-formylphenyltrifluoroborate?
The InChIKey is ZUJWOVZZESBYHA-UHFFFAOYSA-N.
What is the canonical SMILES of Potassium 3-formylphenyltrifluoroborate?
The canonical SMILES is [B-](C1=CC(=CC=C1)C=O)(F)(F)F.[K+].
What is the CAS number of Potassium 3-formylphenyltrifluoroborate?
The CAS number is 871231-44-6.
What is the hydrogen bond donor count of Potassium 3-formylphenyltrifluoroborate?
The hydrogen bond donor count is 0.
Is Potassium 3-formylphenyltrifluoroborate the canonicalized compound?
Yes, Potassium 3-formylphenyltrifluoroborate is canonicalized.
※ Please kindly note that our products are for research use only.