What is the molecular formula of Potassium (2,6-difluorophenyl)trifluoroborate?
The molecular formula is C6H3BF5K.
What are the synonyms for Potassium (2,6-difluorophenyl)trifluoroborate?
The synonyms are Potassium 2,6-difluorophenyltrifluoroborate, potassium (2,6-difluorophenyl)trifluoroboranuide, and potassium;(2,6-difluorophenyl)-trifluoroboranuide.
What is the molecular weight of Potassium (2,6-difluorophenyl)trifluoroborate?
The molecular weight is 219.99 g/mol.
What is the IUPAC name of Potassium (2,6-difluorophenyl)trifluoroborate?
The IUPAC name is potassium;(2,6-difluorophenyl)-trifluoroboranuide.
What is the InChI of Potassium (2,6-difluorophenyl)trifluoroborate?
The InChI is InChI=1S/C6H3BF5.K/c8-4-2-1-3-5(9)6(4)7(10,11)12;/h1-3H;/q-1;+1.
What is the InChIKey of Potassium (2,6-difluorophenyl)trifluoroborate?
The InChIKey is XUCOCDVVPJFGSH-UHFFFAOYSA-N.
What is the canonical SMILES of Potassium (2,6-difluorophenyl)trifluoroborate?
The canonical SMILES is [B-](C1=C(C=CC=C1F)F)(F)(F)F.[K+].
What is the CAS number of Potassium (2,6-difluorophenyl)trifluoroborate?
The CAS number is 267006-25-7.
What is the European Community (EC) Number of Potassium (2,6-difluorophenyl)trifluoroborate?
The EC Number is 806-808-7.
What is the monoisotopic mass of Potassium (2,6-difluorophenyl)trifluoroborate?
The monoisotopic mass is 219.9885026 g/mol.
※ Please kindly note that our products are for research use only.