What is the molecular formula of platanic acid according to the reference?
The molecular formula of platanic acid is C29H46O4.
What is the molecular weight of platanic acid?
The molecular weight of platanic acid is 458.7 g/mol.
What is the IUPAC name of platanic acid?
The IUPAC name of platanic acid is (1R,3aS,5aR,5bR,7aR,9S,11aR,11bR,13aR,13bS)-1-acetyl-9-hydroxy-5a,5b,8,8,11a-pentamethyl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-3a-carboxylic acid.
What is the InChI of platanic acid?
The InChI of platanic acid is InChI=1S/C29H46O4/c1-17(30)18-9-14-29(24(32)33)16-15-27(5)19(23(18)29)7-8-21-26(4)12-11-22(31)25(2,3)20(26)10-13-28(21,27)6/h18-23,31H,7-16H2,1-6H3,(H,32,33)/t18-,19+,20-,21+,22-,23+,26-,27+,28+,29-/m0/s1.
What is the canonical SMILES of platanic acid?
The canonical SMILES of platanic acid is CC(=O)C1CCC2(C1C3CCC4C5(CCC(C(C5CCC4(C3(CC2)C)C)(C)C)O)C)C(=O)O.
What is the CAS number of platanic acid?
The CAS number of platanic acid is 6060-06-6.
What is the ChEMBL ID of platanic acid?
The ChEMBL ID of platanic acid is CHEMBL80460.
What is the hydrogen bond donor count of platanic acid?
The hydrogen bond donor count of platanic acid is 2.
What is the hydrogen bond acceptor count of platanic acid?
The hydrogen bond acceptor count of platanic acid is 4.
What is the topological polar surface area of platanic acid?
The topological polar surface area of platanic acid is 74.6Ų.