What is the molecular formula of Pingpeimine A?
The molecular formula of Pingpeimine A is C27H45NO5.
What is the synonym for Pingpeimine A?
The synonym for Pingpeimine A is Cevane-3,6,14,16,20-pentol.
When was Pingpeimine A created?
Pingpeimine A was created on August 8, 2005.
What is the molecular weight of Pingpeimine A?
The molecular weight of Pingpeimine A is 463.6 g/mol.
What is the IUPAC name of Pingpeimine A?
The IUPAC name of Pingpeimine A is (1S,2S,6S,9S,10S,11R,12S,14R,15R,17S,18S,20S,23R,24S)-6,10,23-trimethyl-4-azahexacyclo[12.11.0.02,11.04,9.015,24.018,23]pentacosane-10,12,14,17,20-pentol.
What is the InChI of Pingpeimine A?
The InChI of Pingpeimine A is InChI=1S/C27H45NO5/c1-14-4-5-23-26(3,32)24-16(13-28(23)12-14)17-9-18-19(27(17,33)11-22(24)31)10-21(30)20-8-15(29)6-7-25(18,20)2/h14-24,29-33H,4-13H2,1-3H3/t14-,15-,16-,17-,18-,19+,20+,21-,22-,23-,24+,25+,26+,27-/m0/s1.
What is the InChIKey of Pingpeimine A?
The InChIKey of Pingpeimine A is IDFMBIWPULRZOJ-LPMWXLNZSA-N.
What is the canonical SMILES of Pingpeimine A?
The canonical SMILES of Pingpeimine A is CC1CCC2C(C3C(CC4(C(C3CN2C1)CC5C4CC(C6C5(CCC(C6)O)C)O)O)O)(C)O.
What is the CAS number of Pingpeimine A?
The CAS number of Pingpeimine A is 82841-67-6.
How many hydrogen bond acceptors does Pingpeimine A have?
Pingpeimine A has 6 hydrogen bond acceptors.