What is the molecular formula of Picolinafen?
The molecular formula of Picolinafen is C19H12F4N2O2.
When was Picolinafen first created?
Picolinafen was first created on September 6, 2005.
What is the primary use of Picolinafen?
Picolinafen is primarily used as a herbicide for the control of broad-leaved weeds in cereal crops.
What is the IUPAC name of Picolinafen?
The IUPAC name of Picolinafen is N-(4-fluorophenyl)-6-[3-(trifluoromethyl)phenoxy]pyridine-2-carboxamide.
What is the molecular weight of Picolinafen?
The molecular weight of Picolinafen is 376.3 g/mol.
What is the InChIKey of Picolinafen?
The InChIKey of Picolinafen is CWKFPEBMTGKLKX-UHFFFAOYSA-N.
How many hydrogen bond acceptor counts does Picolinafen have?
Picolinafen has 7 hydrogen bond acceptor counts.
What is the canonical SMILES representation of Picolinafen?
The canonical SMILES representation of Picolinafen is C1=CC(=CC(=C1)OC2=CC=CC(=N2)C(=O)NC3=CC=C(C=C3)F)C(F)(F)F.
What is the XLogP3-AA value of Picolinafen?
The XLogP3-AA value of Picolinafen is 4.9.
What is the UNII number of Picolinafen?
The UNII number of Picolinafen is VJE2EX3SNN.