| Description |
Colorless transparent liquid |
| Synonyms |
2-Propenoic Acid, 1-Ethylcyclohexyl Ester; 1-Ethylcyclohexyl Acrylate; 1-Ethylcyclohexyl Prop-2-Enoate; (1-Ethylcyclohexyl) Prop-2-Enoate; Mfcd31380101 |
| IUPAC Name |
(1-Ethylcyclohexyl) prop-2-enoate |
| Molecular Weight |
182.26 |
| Molecular Formula |
C11H18O2 |
| Canonical SMILES |
CCC1(CCCCC1)OC(=O)C=C |
| InChI |
FKWURGDTWUGDQB-UHFFFAOYSA-N |
| InChI Key |
InChI=1S/C11H18O2/c1-3-10(12)13-11(4-2)8-6-5-7-9-11/h3H,1,4-9H2,2H3 |
| Purity |
98.0%+ |
| Packaging |
5/10/25 kg/drum; fluorinated bottle packaging. |
Please kindly note that our products and services are for research use only.
