What is the PubChem CID for Phlorizin dihydrate?
The PubChem CID for Phlorizin dihydrate is 9912668.
What is the molecular formula of Phlorizin dihydrate?
The molecular formula of Phlorizin dihydrate is C21H28O12.
What is the molecular weight of Phlorizin dihydrate?
The molecular weight of Phlorizin dihydrate is 472.4 g/mol.
What is the IUPAC name of Phlorizin dihydrate?
The IUPAC name of Phlorizin dihydrate is 1-[2,4-dihydroxy-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-3-(4-hydroxyphenyl)propan-1-one;dihydrate.
What is the InChI of Phlorizin dihydrate?
The InChI of Phlorizin dihydrate is InChI=1S/C21H24O10.2H2O/c22-9-16-18(27)19(28)20(29)21(31-16)30-15-8-12(24)7-14(26)17(15)13(25)6-3-10-1-4-11(23)5-2-10;;/h1-2,4-5,7-8,16,18-24,26-29H,3,6,9H2;2*1H2/t16-,18-,19+,20-,21-;;/m1../s1.
What is the Canonical SMILES of Phlorizin dihydrate?
The Canonical SMILES of Phlorizin dihydrate is C1=CC(=CC=C1CCC(=O)C2=C(C=C(C=C2OC3C(C(C(C(O3)CO)O)O)O)O)O)O.O.O.
What is the CAS number of Phlorizin dihydrate?
The CAS number of Phlorizin dihydrate is 7061-54-3.
What is the European Community (EC) Number of Phlorizin dihydrate?
The European Community (EC) Number of Phlorizin dihydrate is 628-113-6.
What is the hydrogen bond donor count of Phlorizin dihydrate?
The hydrogen bond donor count of Phlorizin dihydrate is 9.
How many defined atom stereocenter counts does Phlorizin dihydrate have?
Phlorizin dihydrate has 5 defined atom stereocenter counts.