What is the molecular formula of Phenylphosphinic acid?
The molecular formula of Phenylphosphinic acid is C6H6O2P+.
What is the molecular weight of Phenylphosphinic acid?
The molecular weight of Phenylphosphinic acid is 141.08 g/mol.
What is the IUPAC name of Phenylphosphinic acid?
The IUPAC name of Phenylphosphinic acid is hydroxy-oxo-phenylphosphanium.
What is the InChI of Phenylphosphinic acid?
The InChI of Phenylphosphinic acid is InChI=1S/C6H5O2P/c7-9(8)6-4-2-1-3-5-6/h1-5H/p+1.
What is the InChIKey of Phenylphosphinic acid?
The InChIKey of Phenylphosphinic acid is KNQVWTDLQQGKSV-UHFFFAOYSA-O.
What is the canonical SMILES of Phenylphosphinic acid?
The canonical SMILES of Phenylphosphinic acid is C1=CC=C(C=C1)[P+](=O)O.
What is the CAS number of Phenylphosphinic acid?
The CAS number of Phenylphosphinic acid is 121-70-0.
What is the European Community (EC) number of Phenylphosphinic acid?
The European Community (EC) number of Phenylphosphinic acid is 217-217-3.
What is the XLogP3-AA value of Phenylphosphinic acid?
The XLogP3-AA value of Phenylphosphinic acid is 0.9.
Is Phenylphosphinic acid a canonicalized compound?
Yes, Phenylphosphinic acid is canonicalized.