What is the PubChem CID of Phenazine ethosulfate?
The PubChem CID of Phenazine ethosulfate is 82688.
What is the molecular formula of Phenazine ethosulfate?
The molecular formula of Phenazine ethosulfate is C16H18N2O4S.
What is the molecular weight of Phenazine ethosulfate?
The molecular weight of Phenazine ethosulfate is 334.4 g/mol.
What are the synonyms of Phenazine ethosulfate?
The synonyms of Phenazine ethosulfate include 10510-77-7, 5-Ethylphenazine, 5-ethylphenazin-5-ium ethyl sulfate, and 5-Ethylphenazinium ethylsulfate.
When was Phenazine ethosulfate created and last modified?
Phenazine ethosulfate was created on August 8, 2005, and last modified on December 30, 2023.
What is the IUPAC name of Phenazine ethosulfate?
The IUPAC name of Phenazine ethosulfate is 5-ethylphenazin-5-ium;ethyl sulfate.
What is the InChIKey of Phenazine ethosulfate?
The InChIKey of Phenazine ethosulfate is VDJKJPMLWJWQIH-UHFFFAOYSA-M.
What is the Canonical SMILES of Phenazine ethosulfate?
The Canonical SMILES of Phenazine ethosulfate is CC[N+]1=C2C=CC=CC2=NC3=CC=CC=C31.CCOS(=O)(=O)[O-].
What is the CAS number of Phenazine ethosulfate?
The CAS number of Phenazine ethosulfate is 10510-77-7.
What is the hydrogen bond acceptor count of Phenazine ethosulfate?
The hydrogen bond acceptor count of Phenazine ethosulfate is 5.