What is the PubChem CID of Perfluorooctanes?
PubChem CID 9387.
What is the molecular formula of Perfluorooctanes?
The molecular formula of Perfluorooctanes is C8F18.
What is the molecular weight of Perfluorooctanes?
The molecular weight of Perfluorooctanes is 438.06 g/mol.
What is the IUPAC name of Perfluorooctanes?
The IUPAC name of Perfluorooctanes is 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-octadecafluorooctane.
What is the InChI of Perfluorooctanes?
The InChI of Perfluorooctanes is InChI=1S/C8F18/c9-1(10,3(13,14)5(17,18)7(21,22)23)2(11,12)4(15,16)6(19,20)8(24,25)26.
What is the InChIKey of Perfluorooctanes?
The InChIKey of Perfluorooctanes is YVBBRRALBYAZBM-UHFFFAOYSA-N.
What is the canonical SMILES of Perfluorooctanes?
The canonical SMILES of Perfluorooctanes is C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(C(C(C(F)(F)F)(F)F)(F)F)(F)F.
What is the CAS number of Perfluorooctanes?
The CAS number of Perfluorooctanes is 307-34-6.
What is the XLogP3-AA value of Perfluorooctanes?
The XLogP3-AA value of Perfluorooctanes is 6.5.
How many hydrogen bond acceptor count does Perfluorooctanes have?
Perfluorooctanes has 18 hydrogen bond acceptor count.