What is the molecular formula of palonosetron?
The molecular formula of palonosetron is C19H24N2O.
What is the molecular weight of palonosetron?
The molecular weight of palonosetron is 296.4 g/mol.
What is the IUPAC name of palonosetron?
The IUPAC name of palonosetron is (3aS)-2-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-3a,4,5,6-tetrahydro-3H-benzo[de]isoquinolin-1-one.
What is the InChI of palonosetron?
The InChI of palonosetron is InChI=1S/C19H24N2O/c22-19-16-6-2-4-14-3-1-5-15(18(14)16)11-21(19)17-12-20-9-7-13(17)8-10-20/h2,4,6,13,15,17H,1,3,5,7-12H2/t15-,17-/m1/s1.
What is the InChIKey of palonosetron?
The InChIKey of palonosetron is CPZBLNMUGSZIPR-NVXWUHKLSA-N.
What is the canonical SMILES of palonosetron?
The canonical SMILES of palonosetron is C1CC2CN(C(=O)C3=CC=CC(=C23)C1)C4CN5CCC4CC5.
What is the trade name of palonosetron?
The trade name of palonosetron is Aloxi.
What is the indication of palonosetron?
Palonosetron is indicated for the prevention and treatment of chemotherapy-induced nausea and vomiting (CINV).
What is the mechanism of action of palonosetron?
The mechanism of action of palonosetron is as a serotonin 3 receptor antagonist.
What is the FDA approval status of palonosetron?
Palonosetron is approved by the U.S. Food and Drug Administration (FDA) for the prevention and treatment of delayed nausea and vomiting that appear more than 24 hours after the first dose of a course of chemotherapy.