What is the molecular formula of p-Tolyl-acetyl chloride?
The molecular formula of p-Tolyl-acetyl chloride is C9H9ClO.
What are some synonyms for p-Tolyl-acetyl chloride?
Some synonyms for p-Tolyl-acetyl chloride are 2-(4-methylphenyl)acetyl chloride, p-tolylacetyl chloride, P-Tolyl-Acetyl Chloride, and p-Tolyl-acetylchloride.
What is the molecular weight of p-Tolyl-acetyl chloride?
The molecular weight of p-Tolyl-acetyl chloride is 168.62 g/mol.
What is the IUPAC name of p-Tolyl-acetyl chloride?
The IUPAC name of p-Tolyl-acetyl chloride is 2-(4-methylphenyl)acetyl chloride.
What is the InChI of p-Tolyl-acetyl chloride?
The InChI of p-Tolyl-acetyl chloride is InChI=1S/C9H9ClO/c1-7-2-4-8(5-3-7)6-9(10)11/h2-5H,6H2,1H3.
What is the InChIKey of p-Tolyl-acetyl chloride?
The InChIKey of p-Tolyl-acetyl chloride is QDZAWVLWIMOXJT-UHFFFAOYSA-N.
What is the canonical SMILES of p-Tolyl-acetyl chloride?
The canonical SMILES of p-Tolyl-acetyl chloride is CC1=CC=C(C=C1)CC(=O)Cl.
What is the CAS number of p-Tolyl-acetyl chloride?
The CAS number of p-Tolyl-acetyl chloride is 35675-44-6.
What is the European Community (EC) number of p-Tolyl-acetyl chloride?
The European Community (EC) number of p-Tolyl-acetyl chloride is 673-227-1.
What is the topological polar surface area of p-Tolyl-acetyl chloride?
The topological polar surface area of p-Tolyl-acetyl chloride is 17.1Ų.