What is the PubChem CID of p-Hydroxyphenyl methacrylate?
The PubChem CID of p-Hydroxyphenyl methacrylate is 93152.
What is the molecular formula of p-Hydroxyphenyl methacrylate?
The molecular formula of p-Hydroxyphenyl methacrylate is C10H10O3.
What are the synonyms of p-Hydroxyphenyl methacrylate?
The synonyms of p-Hydroxyphenyl methacrylate are 31480-93-0, 4-hydroxyphenyl methacrylate, p-Hydroxyphenyl methacrylate, and (4-hydroxyphenyl) 2-methylprop-2-enoate.
What is the molecular weight of p-Hydroxyphenyl methacrylate?
The molecular weight of p-Hydroxyphenyl methacrylate is 178.18 g/mol.
What is the IUPAC name of p-Hydroxyphenyl methacrylate?
The IUPAC name of p-Hydroxyphenyl methacrylate is (4-hydroxyphenyl) 2-methylprop-2-enoate.
What is the InChI of p-Hydroxyphenyl methacrylate?
The InChI of p-Hydroxyphenyl methacrylate is InChI=1S/C10H10O3/c1-7(2)10(12)13-9-5-3-8(11)4-6-9/h3-6,11H,1H2,2H3.
What is the InChIKey of p-Hydroxyphenyl methacrylate?
The InChIKey of p-Hydroxyphenyl methacrylate is PJMXUSNWBKGQEZ-UHFFFAOYSA-N.
What is the canonical SMILES of p-Hydroxyphenyl methacrylate?
The canonical SMILES of p-Hydroxyphenyl methacrylate is CC(=C)C(=O)OC1=CC=C(C=C1)O.
What is the CAS number of p-Hydroxyphenyl methacrylate?
The CAS number of p-Hydroxyphenyl methacrylate is 31480-93-0.
What is the hydrogen bond donor count of p-Hydroxyphenyl methacrylate?
The hydrogen bond donor count of p-Hydroxyphenyl methacrylate is 1.
※ Please kindly note that our products are for research use only.