What is the molecular formula of p-(2-Methoxyethyl)phenol?
The molecular formula is C9H12O2.
What is the molecular weight of p-(2-Methoxyethyl)phenol?
The molecular weight is 152.19 g/mol.
What is the IUPAC name of p-(2-Methoxyethyl)phenol?
The IUPAC name is 4-(2-methoxyethyl)phenol.
What is the InChI of p-(2-Methoxyethyl)phenol?
The InChI is InChI=1S/C9H12O2/c1-11-7-6-8-2-4-9(10)5-3-8/h2-5,10H,6-7H2,1H3.
What is the InChIKey of p-(2-Methoxyethyl)phenol?
The InChIKey is FAYGEALAEQKPDI-UHFFFAOYSA-N.
What is the canonical SMILES of p-(2-Methoxyethyl)phenol?
The canonical SMILES is COCCC1=CC=C(C=C1)O.
What is the CAS number of p-(2-Methoxyethyl)phenol?
The CAS number is 56718-71-9.
What is the ChEMBL ID of p-(2-Methoxyethyl)phenol?
The ChEMBL ID is CHEMBL1094369.
What is the hydrogen bond donor count of p-(2-Methoxyethyl)phenol?
The hydrogen bond donor count is 1.
Is p-(2-Methoxyethyl)phenol a canonicalized compound?
Yes, p-(2-Methoxyethyl)phenol is a canonicalized compound.