What is the molecular formula of Oxolamine citrate salt?
The molecular formula of Oxolamine citrate salt is C20H27N3O8.
What is the molecular weight of Oxolamine citrate salt?
The molecular weight of Oxolamine citrate salt is 437.4 g/mol.
What are the synonyms of Oxolamine citrate salt?
The synonyms of Oxolamine citrate salt are Oxolamine citrate, Oxolamine (citrate), and Oxalamine citrate salt.
What is the IUPAC name of Oxolamine citrate salt?
The IUPAC name of Oxolamine citrate salt is N,N-diethyl-2-(3-phenyl-1,2,4-oxadiazol-5-yl)ethanamine;2-hydroxypropane-1,2,3-tricarboxylic acid.
What is the InChI of Oxolamine citrate salt?
The InChI of Oxolamine citrate salt is InChI=1S/C14H19N3O.C6H8O7/c1-3-17(4-2)11-10-13-15-14(16-18-13)12-8-6-5-7-9-12;7-3(8)1-6(13,5(11)12)2-4(9)10/h5-9H,3-4,10-11H2,1-2H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12).
What is the InChIKey of Oxolamine citrate salt?
The InChIKey of Oxolamine citrate salt is RBZIGQJSMCOHSS-UHFFFAOYSA-N.
What is the canonical SMILES of Oxolamine citrate salt?
The canonical SMILES of Oxolamine citrate salt is CCN(CC)CCC1=NC(=NO1)C2=CC=CC=C2.C(C(=O)O)C(CC(=O)O)(C(=O)O)O.
What is the CAS number of Oxolamine citrate salt?
The CAS number of Oxolamine citrate salt is 1949-20-8.
What is the hydrocarbon bond donor count of Oxolamine citrate salt?
The hydrocarbon bond donor count of Oxolamine citrate salt is 4.
Is Oxolamine citrate salt a covalently-bonded unit?
Yes, Oxolamine citrate salt is a covalently-bonded unit.