What is the molecular formula of Oxazol-2-ylboronic acid?
The molecular formula of Oxazol-2-ylboronic acid is C3H4BNO3.
What is the molecular weight of Oxazol-2-ylboronic acid?
The molecular weight of Oxazol-2-ylboronic acid is 112.88 g/mol.
What is the IUPAC name of Oxazol-2-ylboronic acid?
The IUPAC name of Oxazol-2-ylboronic acid is 1,3-oxazol-2-ylboronic acid.
What is the InChI of Oxazol-2-ylboronic acid?
The InChI of Oxazol-2-ylboronic acid is InChI=1S/C3H4BNO3/c6-4(7)3-5-1-2-8-3/h1-2,6-7H.
What is the InChIKey of Oxazol-2-ylboronic acid?
The InChIKey of Oxazol-2-ylboronic acid is NRBQYBDDNGRAOR-UHFFFAOYSA-N.
What is the canonical SMILES of Oxazol-2-ylboronic acid?
The canonical SMILES of Oxazol-2-ylboronic acid is B(C1=NC=CO1)(O)O.
How many hydrogen bond donor counts does Oxazol-2-ylboronic acid have?
Oxazol-2-ylboronic acid has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does Oxazol-2-ylboronic acid have?
Oxazol-2-ylboronic acid has 4 hydrogen bond acceptor counts.
How many rotatable bond counts does Oxazol-2-ylboronic acid have?
Oxazol-2-ylboronic acid has 1 rotatable bond count.
Is Oxazol-2-ylboronic acid considered as a canonicalized compound?
Yes, Oxazol-2-ylboronic acid is considered as a canonicalized compound.