| Catalog | OFC866395166 |
| CAS | 866395-16-6 |
| Category | Fluorinated Metal Complexes |
| Synonyms | [Au(NTf)2(PPh3)] |
| Purity | >99% |
| MDL Number | MFCD12911910 |
※ Please kindly note that our products are for research use only.
| IUPAC Name | bis(trifluoromethylsulfonyl)azanide; gold(1+); triphenylphosphane |
| InChI | InChI=1S/C18H15P.C2F6NO4S2.Au/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8;/h1-15H;;/q;-1;+1 |
| InChI Key | GJWZOHAPYGHXHP-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=CC=C3.C(F)(F)(F)S(=O)(=O)[N-]S(=O)(=O)C(F)(F)F.[Au+] |
| Molecular Formula | C20H15AuF6NO4PS2 |
| Molecular Weight | 739.4 |
| Appearance | Off-white to gray-violet powder |
| Solubility | Insoluble in water |
| Exact Mass | 738.975001 g/mol |
| Monoisotopic Mass | 738.975001 g/mol |
Please kindly note that our products and services are for research use only.