| Catalog | OFC124898131 |
| CAS | 124898-13-1 |
| Category | Perfluoroalkylation Agents |
| Synonyms | (Pentafluoroethyl)Trimethylsilane |
| Purity | 98% |
| MDL Number | MFCD04116436 |
※ Please kindly note that our products are for research use only.
| IUPAC Name | trimethyl(1,1,2,2,2-pentafluoroethyl)silane |
| InChI | InChI=1S/C5H9F5Si/c1-11(2,3)5(9,10)4(6,7)8/h1-3H3 |
| InChI Key | MTPVUVINMAGMJL-UHFFFAOYSA-N |
| Isomeric SMILES | C[Si](C)(C)C(C(F)(F)F)(F)F |
| EC Number | 673-912-5 |
| Molecular Formula | C5H9F5Si |
| Molecular Weight | 192.20 |
| Boiling Point | 60 °C |
| Density | 1.095 g/mL |
| Specific Gravity | 1.05 |
| Refractive Index | 1.3270 |
| Appearance | Colorless liquid |
| Solubility | Miscible with tetrahydrofuran |
| Storage | Keep in dark place, inert atmosphere, 2-8°C |
| Stability | Moisture sensitive |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 1 |
| Exact Mass | 192.03936763 g/mol |
| Monoisotopic Mass | 192.03936763 g/mol |
| Topological Polar Surface Area | 0Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 142 |
| HS Number | 2931.90.9010 |
Please kindly note that our products and services are for research use only.