| Catalog | OFC220880126 |
| CAS | 220880-12-6 |
| Category | Fluorinated Pyrimidines |
| Synonyms | 5-Pyrimidinecarboxylic acid, 4-(trifluoromethyl)- |
| MDL Number | MFCD11106713 |
※ Please kindly note that our products are for research use only.
| IUPAC Name | 4-(trifluoromethyl)pyrimidine-5-carboxylic acid |
| InChI | InChI=1S/C6H3F3N2O2/c7-6(8,9)4-3(5(12)13)1-10-2-11-4/h1-2H,(H,12,13) |
| InChI Key | OQHVVOYDDRBQRI-UHFFFAOYSA-N |
| Isomeric SMILES | C1=C(C(=NC=N1)C(F)(F)F)C(=O)O |
| Molecular Formula | C6H3F3N2O2 |
| Molecular Weight | 192.10 |
| XLogP3-AA | 0.6 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 7 |
| Rotatable Bond Count | 1 |
| Exact Mass | 192.01466183 g/mol |
| Monoisotopic Mass | 192.01466183 g/mol |
| Topological Polar Surface Area | 63.1Ų |
| Heavy Atom Count | 13 |
| Formal Charge | 0 |
| Complexity | 207 |
Please kindly note that our products and services are for research use only.