| Catalog | OFC866019763 |
| CAS | 866019-76-3 |
| Category | Fluorinated Pyrimidines |
| Synonyms | 4-[3-(trifluoromethyl)phenyl]-2-pyrimidinylamine |
| Purity | tech |
| MDL Number | MFCD03407835 |
※ Please kindly note that our products are for research use only.
| IUPAC Name | 4-[3-(trifluoromethyl)phenyl]pyrimidin-2-amine |
| InChI | InChI=1S/C11H8F3N3/c12-11(13,14)8-3-1-2-7(6-8)9-4-5-16-10(15)17-9/h1-6H,(H2,15,16,17) |
| InChI Key | XHPUQDCNDMTXSO-UHFFFAOYSA-N |
| Isomeric SMILES | C1=CC(=CC(=C1)C(F)(F)F)C2=NC(=NC=C2)N |
| Molecular Formula | C11H8F3N3 |
| Molecular Weight | 239.20 |
| XLogP3-AA | 2.4 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 1 |
| Exact Mass | 239.06703175 g/mol |
| Monoisotopic Mass | 239.06703175 g/mol |
| Topological Polar Surface Area | 51.8Ų |
| Heavy Atom Count | 17 |
| Formal Charge | 0 |
| Complexity | 257 |
Please kindly note that our products and services are for research use only.