| Catalog | OFC1428542 |
| CAS | 1428-54-2 |
| Category | Fluorinated Cyclic Ethers |
| Synonyms | Oxirane, [3-(trifluoromethyl)phenyl]- |
| MDL Number | MFCD09741315 |
※ Please kindly note that our products are for research use only.
| IUPAC Name | 2-[3-(trifluoromethyl)phenyl]oxirane |
| InChI | InChI=1S/C9H7F3O/c10-9(11,12)7-3-1-2-6(4-7)8-5-13-8/h1-4,8H,5H2 |
| InChI Key | SDZLYPFMASMVQF-UHFFFAOYSA-N |
| Isomeric SMILES | C1C(O1)C2=CC(=CC=C2)C(F)(F)F |
| Molecular Formula | C9H7F3O |
| Molecular Weight | 188.15 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 1 |
| Exact Mass | 188.04489933 g/mol |
| Monoisotopic Mass | 188.04489933 g/mol |
| Topological Polar Surface Area | 12.5Ų |
| Heavy Atom Count | 13 |
| Formal Charge | 0 |
| Complexity | 190 |
Please kindly note that our products and services are for research use only.