| Catalog | OFC175676423 |
| CAS | 175676-42-3 |
| Category | Trifluoromethylation Agents |
| Purity | 95% |
| MDL Number | MFCD31695793 |
※ Please kindly note that our products are for research use only.
| IUPAC Name | trifluoromethyl 4-methylbenzenesulfonate |
| InChI | InChI=1S/C8H7F3O3S/c1-6-2-4-7(5-3-6)15(12,13)14-8(9,10)11/h2-5H,1H3 |
| InChI Key | NHBKFPDJMAEDOS-UHFFFAOYSA-N |
| Isomeric SMILES | CC1=CC=C(C=C1)S(=O)(=O)OC(F)(F)F |
| Molecular Formula | C8H7F3O3S |
| Molecular Weight | 240.20 |
| Storage | Sealed in dry, 2-8 °C |
| XLogP3-AA | 2.8 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 2 |
| Exact Mass | 240.00679974 g/mol |
| Monoisotopic Mass | 240.00679974 g/mol |
| Topological Polar Surface Area | 51.8Ų |
| Heavy Atom Count | 15 |
| Formal Charge | 0 |
| Complexity | 196 |
Please kindly note that our products and services are for research use only.