| Catalog | OFC131880165-2 |
| CAS | 131880-16-5 |
| Category | Trifluoromethylation Agents |
| Purity | 95% |
| MDL Number | MFCD01073545 |
※ Please kindly note that our products are for research use only.
| IUPAC Name | 5-(trifluoromethyl)dibenzothiophen-5-ium;tetrafluoroborate |
| InChI | InChI=1S/C13H8F3S.BF4/c14-13(15,16)17-11-7-3-1-5-9(11)10-6-2-4-8-12(10)17;2-1(3,4)5/h1-8H;/q+1;-1 |
| InChI Key | VTVISWLINKWMQZ-UHFFFAOYSA-N |
| Isomeric SMILES | [B-](F)(F)(F)F.C1=CC=C2C(=C1)C3=CC=CC=C3[S+]2C(F)(F)F |
| EC Number | 806-503-9 |
| Molecular Formula | C13H8BF7S |
| Molecular Weight | 340.07 |
| Storage | Keep in dark place, inert atmosphere, room temperature |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 8 |
| Rotatable Bond Count | 0 |
| Exact Mass | 340.0327987 g/mol |
| Monoisotopic Mass | 340.0327987 g/mol |
| Topological Polar Surface Area | 1Ų |
| Heavy Atom Count | 22 |
| Formal Charge | 0 |
| Complexity | 286 |
Please kindly note that our products and services are for research use only.