| Catalog | OFC129946889-2 |
| CAS | 129946-88-9 |
| Category | Trifluoromethylation Agents |
| Synonyms | S-(Trifluoromethyl)Dibenzothiophenium Trifluoromethanesulfonate |
| Purity | 97% |
| MDL Number | MFCD00236132 |
※ Please kindly note that our products are for research use only.
| IUPAC Name | trifluoromethanesulfonate;5-(trifluoromethyl)dibenzothiophen-5-ium |
| InChI | InChI=1S/C13H8F3S.CHF3O3S/c14-13(15,16)17-11-7-3-1-5-9(11)10-6-2-4-8-12(10)17;2-1(3,4)8(5,6)7/h1-8H;(H,5,6,7)/q+1;/p-1 |
| InChI Key | QXXHXTRTGZBOGD-UHFFFAOYSA-M |
| Isomeric SMILES | C1=CC=C2C(=C1)C3=CC=CC=C3[S+]2C(F)(F)F.C(F)(F)(F)S(=O)(=O)[O-] |
| EC Number | 627-294-9 |
| Molecular Formula | C14H8F6O3S2 |
| Molecular Weight | 402.33 |
| Storage | Keep in dark place, inert atmosphere, room temperature |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 9 |
| Rotatable Bond Count | 0 |
| Exact Mass | 401.98190543 g/mol |
| Monoisotopic Mass | 401.98190543 g/mol |
| Topological Polar Surface Area | 66.6Ų |
| Heavy Atom Count | 25 |
| Formal Charge | 0 |
| Complexity | 412 |
Please kindly note that our products and services are for research use only.