| Catalog | OFC2356163-1 |
| CAS | 2356-16-3 |
| Category | Other Fluorinated Group Introducing Agents |
| Synonyms | (Diethoxyphosphinyl)fluoroacetic Acid Ethyl Ester; Ethyl (Diethoxyphosphinyl)fluoroacetate; 2-Fluoro-2-phosphonoacetic Acid Triethyl Ester |
| Purity | >95.0%(GC) |
| MDL Number | MFCD00134400 |
※ Please kindly note that our products are for research use only.
| IUPAC Name | ethyl 2-diethoxyphosphoryl-2-fluoroacetate |
| InChI | InChI=1S/C8H16FO5P/c1-4-12-8(10)7(9)15(11,13-5-2)14-6-3/h7H,4-6H2,1-3H3 |
| InChI Key | FVPISMANESAJQZ-UHFFFAOYSA-N |
| Isomeric SMILES | CCOC(=O)C(F)P(=O)(OCC)OCC |
| EC Number | 627-648-2 |
| Reaxys Registry Number | 1912161 |
| Molecular Formula | C8H16FO5P |
| Molecular Weight | 242.18 |
| Boiling Point | 200 °C (16 mmHg) |
| Flash Point | 73 °C |
| Specific Gravity | 1.19 |
| Refractive Index | 1.42 |
| Appearance | Colorless to almost colorless clear liquid |
| Storage | Store under inert gas |
| Stability | Moisture sensitive, Heat sensitive |
| XLogP3-AA | 1 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 8 |
| Exact Mass | 242.07193877 g/mol |
| Monoisotopic Mass | 242.07193877 g/mol |
| Topological Polar Surface Area | 61.8Ų |
| Heavy Atom Count | 15 |
| Formal Charge | 0 |
| Complexity | 235 |
| HS Number | 2931.90.9051 |
Please kindly note that our products and services are for research use only.