| Catalog | OFC243139608 |
| CAS | 243139-60-8 |
| Category | Fluorinated Cyclic Ethers |
| Synonyms | 4,5,5,5-Tetrafluoro-4-(trifluoromethoxy)-1,2-epoxypentane |
| MDL Number | MFCD00155980 |
※ Please kindly note that our products are for research use only.
| IUPAC Name | 2-[2,3,3,3-tetrafluoro-2-(trifluoromethoxy)propyl]oxirane |
| InChI | InChI=1S/C6H5F7O2/c7-4(5(8,9)10,1-3-2-14-3)15-6(11,12)13/h3H,1-2H2 |
| InChI Key | YLTWQTPPDBTMJI-UHFFFAOYSA-N |
| Isomeric SMILES | C1C(O1)CC(C(F)(F)F)(OC(F)(F)F)F |
| EC Number | 631-053-3 |
| Molecular Formula | C6H5F7O2 |
| Molecular Weight | 242.09 |
| XLogP3-AA | 2.8 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 9 |
| Rotatable Bond Count | 3 |
| Exact Mass | 242.01777653 g/mol |
| Monoisotopic Mass | 242.01777653 g/mol |
| Topological Polar Surface Area | 21.8Ų |
| Heavy Atom Count | 15 |
| Formal Charge | 0 |
| Complexity | 235 |
Please kindly note that our products and services are for research use only.