| Catalog | OFC243128429 |
| CAS | 243128-42-9 |
| Category | Fluorinated Cyclic Ethers |
| Synonyms | 2,3,3,3-Tetrafluoro-2-(heptafluoropropoxy)propyloxirane |
| MDL Number | MFCD00155948 |
※ Please kindly note that our products are for research use only.
| IUPAC Name | 2-[2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propyl]oxirane |
| InChI | InChI=1S/C8H5F11O2/c9-4(6(12,13)14,1-3-2-20-3)21-8(18,19)5(10,11)7(15,16)17/h3H,1-2H2 |
| InChI Key | CSMFZPWRCMEYPI-UHFFFAOYSA-N |
| Isomeric SMILES | C1C(O1)CC(C(F)(F)F)(OC(C(C(F)(F)F)(F)F)(F)F)F |
| Molecular Formula | C8H5F11O2 |
| Molecular Weight | 342.11 |
| XLogP3-AA | 4.1 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 13 |
| Rotatable Bond Count | 5 |
| Exact Mass | 342.01138918 g/mol |
| Monoisotopic Mass | 342.01138918 g/mol |
| Topological Polar Surface Area | 21.8Ų |
| Heavy Atom Count | 21 |
| Formal Charge | 0 |
| Complexity | 387 |
Please kindly note that our products and services are for research use only.