| Catalog | OFC32996331 |
| CAS | 32996-33-1 |
| Category | Fluorinated Indoles |
| Synonyms | 2-(4,5,6,7-tetrafluoro-1H-indol-3-yl)acetic acid |
| MDL Number | MFCD00203228 |
※ Please kindly note that our products are for research use only.
| IUPAC Name | 2-(4,5,6,7-tetrafluoro-1H-indol-3-yl)acetic acid |
| InChI | InChI=1S/C10H5F4NO2/c11-6-5-3(1-4(16)17)2-15-10(5)9(14)8(13)7(6)12/h2,15H,1H2,(H,16,17) |
| InChI Key | ULAKIDXRHVHYMK-UHFFFAOYSA-N |
| Isomeric SMILES | C1=C(C2=C(N1)C(=C(C(=C2F)F)F)F)CC(=O)O |
| Molecular Formula | C10H5F4NO2 |
| Molecular Weight | 247.15 |
| Melting Point | 214-28 °C(dec.) |
| XLogP3-AA | 1.9 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 2 |
| Exact Mass | 247.02564105 g/mol |
| Monoisotopic Mass | 247.02564105 g/mol |
| Topological Polar Surface Area | 53.1Ų |
| Heavy Atom Count | 17 |
| Formal Charge | 0 |
| Complexity | 317 |
Please kindly note that our products and services are for research use only.