| Catalog | OFC22206571 |
| CAS | 22206-57-1 |
| Category | Nucleophilic Fluorination Agents |
| Synonyms | TBAF Hydrate |
| Purity | >98.0%(T) |
| MDL Number | MFCD00011747 |
※ Please kindly note that our products are for research use only.
| IUPAC Name | tetrabutylazanium;fluoride;hydrate |
| InChI | InChI=1S/C16H36N.FH.H2O/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;;/h5-16H2,1-4H3;1H;1H2/q+1;;/p-1 |
| InChI Key | UQCWXKSHRQJGPH-UHFFFAOYSA-M |
| Isomeric SMILES | CCCC[N+](CCCC)(CCCC)CCCC.O.[F-] |
| Canonical SMILES | CCCC[N+](CCCC)(CCCC)CCCC.O.[F-] |
| EC Number | 684-182-2 |
| Reaxys Registry Number | 3570522 |
| Molecular Formula | C16H36FN·xH2O |
| Molecular Weight | 261.47 (as Anhydrous) |
| Melting Point | 62-63 °C |
| Appearance | White to almost white powder to crystal |
| Storage | Store under inert gas |
| Stability | Moisture sensitive |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 12 |
| Exact Mass | 279.29374300 g/mol |
| Monoisotopic Mass | 279.29374300 g/mol |
| Topological Polar Surface Area | 1Ų |
| Heavy Atom Count | 19 |
| Formal Charge | 0 |
| Complexity | 116 |
| HS Number | 2923.90.0100 |
Please kindly note that our products and services are for research use only.