| Catalog | OFC23868340 |
| CAS | 23868-34-0 |
| Category | Nucleophilic Fluorination Agents |
| Synonyms | Tetrabutylammonium Hydrogen Difluoride |
| Purity | >95.0%(T) |
| MDL Number | MFCD00077877 |
※ Please kindly note that our products are for research use only.
| IUPAC Name | tetrabutylazanium;fluoride;hydrofluoride |
| InChI | InChI=1S/C16H36N.2FH/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;;/h5-16H2,1-4H3;2*1H/q+1;;/p-1 |
| InChI Key | ZHBDKVWQJKYIFF-UHFFFAOYSA-M |
| Isomeric SMILES | CCCC[N+](CCCC)(CCCC)CCCC.F.[F-] |
| EC Number | 629-504-4 |
| Reaxys Registry Number | 4729304 |
| Molecular Formula | C16H37F2N |
| Molecular Weight | 281.48 |
| Appearance | Colorless to red to green clear liquid |
| Storage | Store under inert gas |
| Stability | Hygroscopic |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 12 |
| Exact Mass | 281.28940651 g/mol |
| Monoisotopic Mass | 281.28940651 g/mol |
| Topological Polar Surface Area | 0Ų |
| Heavy Atom Count | 19 |
| Formal Charge | 0 |
| Complexity | 116 |
| HS Number | 2923.90.0100 |
Please kindly note that our products and services are for research use only.