| Catalog | OFC649550152 |
| CAS | 649550-15-2 |
| Category | Fluorinated Benzimidazoles |
| MDL Number | MFCD00662048 |
※ Please kindly note that our products are for research use only.
| IUPAC Name | 2-tert-butyl-1,3-dimethylbenzimidazol-3-ium;tetrafluoroborate |
| InChI | InChI=1S/C13H19N2.BF4/c1-13(2,3)12-14(4)10-8-6-7-9-11(10)15(12)5;2-1(3,4)5/h6-9H,1-5H3;/q+1;-1 |
| InChI Key | DLMJEBYVUGWVDO-UHFFFAOYSA-N |
| Isomeric SMILES | [B-](F)(F)(F)F.CC(C)(C)C1=[N+](C2=CC=CC=C2N1C)C |
| Molecular Formula | C13H19BF4N2 |
| Molecular Weight | 290.11 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 1 |
| Exact Mass | 290.1577414 g/mol |
| Monoisotopic Mass | 290.1577414 g/mol |
| Topological Polar Surface Area | 8.8Ų |
| Heavy Atom Count | 20 |
| Formal Charge | 0 |
| Complexity | 232 |
Please kindly note that our products and services are for research use only.