| Catalog | OFC191591487 |
| CAS | 191591-48-7 |
| Category | Fluorinated Cyclic Ethers |
| Synonyms | 2-Ethenyl-3-phenyl-2-(trifluoromethyl)oxirane; 3,4-Epoxy-4-phenyl-3-(trifluoromethyl)but-1-ene |
| MDL Number | MFCD01318169 |
※ Please kindly note that our products are for research use only.
| IUPAC Name | 2-ethenyl-3-phenyl-2-(trifluoromethyl)oxirane |
| InChI | InChI=1S/C11H9F3O/c1-2-10(11(12,13)14)9(15-10)8-6-4-3-5-7-8/h2-7,9H,1H2 |
| InChI Key | WCHCVYVBILPZQC-UHFFFAOYSA-N |
| Isomeric SMILES | C=CC1(C(O1)C2=CC=CC=C2)C(F)(F)F |
| Molecular Formula | C11H9F3O |
| Molecular Weight | 214.18 |
| Boiling Point | 59-63 °C (5 mmHg) |
| Flash Point | 110 °C |
| XLogP3-AA | 3 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 2 |
| Exact Mass | 214.06054939 g/mol |
| Monoisotopic Mass | 214.06054939 g/mol |
| Topological Polar Surface Area | 12.5Ų |
| Heavy Atom Count | 15 |
| Formal Charge | 0 |
| Complexity | 255 |
Please kindly note that our products and services are for research use only.