| Catalog | OFC375724-2 |
| CAS | 375-72-4 |
| Category | Nucleophilic Fluorination Agents |
| Synonyms | Nonafluoro-1-butanesulfonyl Fluoride |
| Purity | >96.0%(GC) |
| MDL Number | MFCD00007422 |
※ Please kindly note that our products are for research use only.
| IUPAC Name | 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonyl fluoride |
| InChI | InChI=1S/C4F10O2S/c5-1(6,3(9,10)11)2(7,8)4(12,13)17(14,15)16 |
| InChI Key | LUYQYZLEHLTPBH-UHFFFAOYSA-N |
| Isomeric SMILES | C(C(C(F)(F)S(=O)(=O)F)(F)F)(C(F)(F)F)(F)F |
| EC Number | 206-792-6 |
| Reaxys Registry Number | 1813589 |
| Molecular Formula | C4F10O2S |
| Molecular Weight | 302.09 |
| Boiling Point | 65 °C |
| Appearance | Colorless to almost colorless clear liquid |
| Storage | Store under inert gas |
| Stability | Moisture sensitive |
| XLogP3-AA | 3.4 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 12 |
| Rotatable Bond Count | 3 |
| Exact Mass | 301.94593203 g/mol |
| Monoisotopic Mass | 301.94593203 g/mol |
| Topological Polar Surface Area | 42.5Ų |
| Heavy Atom Count | 17 |
| Formal Charge | 0 |
| Complexity | 386 |
| HS Number | 2904.99.5000 |
Please kindly note that our products and services are for research use only.