| Catalog | OFC13561858 |
| CAS | 13561-85-8 |
| Category | Fluorinated Cyclic Ethers |
| Synonyms | (Epoxyethyl)pentafluorobenzene |
| MDL Number | MFCD01075280 |
※ Please kindly note that our products are for research use only.
| IUPAC Name | 2-(2,3,4,5,6-pentafluorophenyl)oxirane |
| InChI | InChI=1S/C8H3F5O/c9-4-3(2-1-14-2)5(10)7(12)8(13)6(4)11/h2H,1H2 |
| InChI Key | ZUZPTXICNGFRDG-UHFFFAOYSA-N |
| Isomeric SMILES | C1C(O1)C2=C(C(=C(C(=C2F)F)F)F)F |
| Molecular Formula | C8H3F5O |
| Molecular Weight | 210.10 |
| Boiling Point | 70-72 °C |
| XLogP3-AA | 1.9 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 1 |
| Exact Mass | 210.01040553 g/mol |
| Monoisotopic Mass | 210.01040553 g/mol |
| Topological Polar Surface Area | 12.5Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 210 |
Please kindly note that our products and services are for research use only.