| Catalog | OFC1046786086-1 |
| CAS | 1046786-08-6 |
| Category | Trifluoromethylation Agents |
| Synonyms | Shibata Reagent I |
| Purity | >98.0%(HPLC)(N) |
※ Please kindly note that our products are for research use only.
| InChI | InChI=1S/C9H11F3NOS.BF4/c1-13(2)15(14,9(10,11)12)8-6-4-3-5-7-8;2-1(3,4)5/h3-7H,1-2H3;/q+1;-1 |
| InChI Key | JQIUQSKIGNTITL-UHFFFAOYSA-N |
| Isomeric SMILES | [B-](F)(F)(F)F.CN(C)[S+](=O)(C1=CC=CC=C1)C(F)(F)F |
| EC Number | 678-325-8 |
| Reaxys Registry Number | 18875566 |
| Molecular Formula | C9H11BF7NOS |
| Molecular Weight | 325.05 |
| Appearance | White to almost white powder to crystal |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 10 |
| Rotatable Bond Count | 2 |
| Exact Mass | 325.0542624 g/mol |
| Monoisotopic Mass | 325.0542624 g/mol |
| Topological Polar Surface Area | 21.3Ų |
| Heavy Atom Count | 20 |
| Formal Charge | 0 |
| Complexity | 278 |
| HS Number | 2930.90.2900 |
Please kindly note that our products and services are for research use only.