| Catalog | OFC19932275 |
| CAS | 19932-27-5 |
| Category | Fluorinated Cyclic Ethers |
| Synonyms | 2-{[(2,2,3,3,4,4,5,5-Octafluoropent-1-yl)oxy]methyl}oxirane; 2-(4,4,5,5,6,6,7,7-Octafluoro-2-oxaheptyl)oxirane; Glycidyl 2,2,3,3,4,4,5,5-octafluoropentyl ether |
| Purity | 97% |
| MDL Number | MFCD00054692 |
※ Please kindly note that our products are for research use only.
| IUPAC Name | 2-(2,2,3,3,4,4,5,5-octafluoropentoxymethyl)oxirane |
| InChI | InChI=1S/C8H8F8O2/c9-5(10)7(13,14)8(15,16)6(11,12)3-17-1-4-2-18-4/h4-5H,1-3H2 |
| InChI Key | NABHRPSATHTFNS-UHFFFAOYSA-N |
| Isomeric SMILES | C1C(O1)COCC(C(C(C(F)F)(F)F)(F)F)(F)F |
| EC Number | 671-730-0 |
| Molecular Formula | C8H8F8O2 |
| Molecular Weight | 288.14 |
| Boiling Point | 75-79 °C (4 mmHg) |
| Density | 1.509 g/cm3 |
| Refractive Index | 1.353 |
| XLogP3-AA | 2.6 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 10 |
| Rotatable Bond Count | 7 |
| Exact Mass | 288.03965479 g/mol |
| Monoisotopic Mass | 288.03965479 g/mol |
| Topological Polar Surface Area | 21.8Ų |
| Heavy Atom Count | 18 |
| Formal Charge | 0 |
| Complexity | 293 |
Please kindly note that our products and services are for research use only.