| Catalog | OFC1647073468-1 |
| CAS | 1647073-46-8 |
| Category | Trifluoromethylthiolation Agents |
| Synonyms | 2-[(Trifluoromethyl)Thio]-1,1-Dioxide-1,2-Benzisothiazol-3(2H)-One |
| Purity | 98% |
| MDL Number | MFCD28127153 |
※ Please kindly note that our products are for research use only.
| IUPAC Name | 1,1-dioxo-2-(trifluoromethylsulfanyl)-1,2-benzothiazol-3-one |
| InChI | InChI=1S/C8H4F3NO3S2/c9-8(10,11)16-12-7(13)5-3-1-2-4-6(5)17(12,14)15/h1-4H |
| InChI Key | KNDYXRJLEZMPBC-UHFFFAOYSA-N |
| Isomeric SMILES | C1=CC=C2C(=C1)C(=O)N(S2(=O)=O)SC(F)(F)F |
| EC Number | 889-022-7 |
| Molecular Formula | C8H4F3NO3S2 |
| Molecular Weight | 283.25 |
| Storage | Keep in dark place, inert atmosphere, 2-8 °C |
| XLogP3-AA | 2.2 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 7 |
| Rotatable Bond Count | 1 |
| Exact Mass | 282.95846982 g/mol |
| Monoisotopic Mass | 282.95846982 g/mol |
| Topological Polar Surface Area | 88.1Ų |
| Heavy Atom Count | 17 |
| Formal Charge | 0 |
| Complexity | 428 |
Please kindly note that our products and services are for research use only.