| Catalog | OFC719982 |
| CAS | 719-98-2 |
| Category | Trifluoromethylthiolation Agents |
| Synonyms | 2-(Trifluoromethylsulfanyl)Isoindole-1,3-Dione |
| Purity | >98.0%(GC) |
※ Please kindly note that our products are for research use only.
| IUPAC Name | 2-(trifluoromethylsulfanyl)isoindole-1,3-dione |
| InChI | InChI=1S/C9H4F3NO2S/c10-9(11,12)16-13-7(14)5-3-1-2-4-6(5)8(13)15/h1-4H |
| InChI Key | CFNSRIIHFLPQCE-UHFFFAOYSA-N |
| Isomeric SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)SC(F)(F)F |
| EC Number | 808-179-4 |
| Reaxys Registry Number | 1464619 |
| Molecular Formula | C9H4F3NO2S |
| Molecular Weight | 247.19 |
| Melting Point | 111.0-115.0 °C |
| Appearance | White to almost white powder to crystal |
| Storage | Store under inert gas |
| Stability | Air sensitive |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 1 |
| Exact Mass | 246.99148403 g/mol |
| Monoisotopic Mass | 246.99148403 g/mol |
| Topological Polar Surface Area | 62.7Ų |
| Heavy Atom Count | 16 |
| Formal Charge | 0 |
| Complexity | 307 |
| HS Number | 2930.90.2900 |
Please kindly note that our products and services are for research use only.