| Catalog | OFC900182992 |
| CAS | 900182-99-2 |
| Category | Fluorinated Indoles |
| Purity | 95% |
| MDL Number | MFCD11111757 |
※ Please kindly note that our products are for research use only.
| IUPAC Name | 2-methyl-5-(trifluoromethoxy)-1H-indole |
| InChI | InChI=1S/C10H8F3NO/c1-6-4-7-5-8(15-10(11,12)13)2-3-9(7)14-6/h2-5,14H,1H3 |
| InChI Key | LFVRFYLUTQMYHC-UHFFFAOYSA-N |
| Isomeric SMILES | CC1=CC2=C(N1)C=CC(=C2)OC(F)(F)F |
| Molecular Formula | C10H8F3NO |
| Molecular Weight | 215.17 |
| Storage | Inert atmosphere, 2-8 °C |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 1 |
| Exact Mass | 215.05579836 g/mol |
| Monoisotopic Mass | 215.05579836 g/mol |
| Topological Polar Surface Area | 25Ų |
| Heavy Atom Count | 15 |
| Formal Charge | 0 |
| Complexity | 231 |
Please kindly note that our products and services are for research use only.