| Catalog | OFC338424387 |
| CAS | 338424-38-7 |
| Category | Fluorinated Cyclic Ethers |
| Synonyms | 2-methyl-N-[3-(trifluoromethyl)phenyl]-2-oxiranecarboxamide |
| Purity | 97% |
| MDL Number | MFCD00232083 |
※ Please kindly note that our products are for research use only.
| IUPAC Name | 2-methyl-N-[3-(trifluoromethyl)phenyl]oxirane-2-carboxamide |
| InChI | InChI=1S/C11H10F3NO2/c1-10(6-17-10)9(16)15-8-4-2-3-7(5-8)11(12,13)14/h2-5H,6H2,1H3,(H,15,16) |
| InChI Key | KBAIZDIRTZZBAQ-UHFFFAOYSA-N |
| Isomeric SMILES | CC1(CO1)C(=O)NC2=CC=CC(=C2)C(F)(F)F |
| Molecular Formula | C11H10F3NO2 |
| Molecular Weight | 245.20 |
| Melting Point | 62-66 °C |
| XLogP3-AA | 1.9 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 2 |
| Exact Mass | 245.06636305 g/mol |
| Monoisotopic Mass | 245.06636305 g/mol |
| Topological Polar Surface Area | 41.6Ų |
| Heavy Atom Count | 17 |
| Formal Charge | 0 |
| Complexity | 318 |
Please kindly note that our products and services are for research use only.