| Catalog | OFC2231674192 |
| CAS | 2231674-19-2 |
| Category | Fluorinated Cyclic Ethers |
| MDL Number | MFCD31561222 |
※ Please kindly note that our products are for research use only.
| IUPAC Name | 3-methyl-2,2-bis[4-(trifluoromethoxy)phenyl]oxirane |
| InChI | InChI=1S/C17H12F6O3/c1-10-15(24-10,11-2-6-13(7-3-11)25-16(18,19)20)12-4-8-14(9-5-12)26-17(21,22)23/h2-10H,1H3 |
| InChI Key | FAMDUVMZLWIKME-UHFFFAOYSA-N |
| Isomeric SMILES | CC1C(O1)(C2=CC=C(C=C2)OC(F)(F)F)C3=CC=C(C=C3)OC(F)(F)F |
| Molecular Formula | C17H12F6O3 |
| Molecular Weight | 378.27 |
| XLogP3-AA | 5.7 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 9 |
| Rotatable Bond Count | 4 |
| Exact Mass | 378.06906321 g/mol |
| Monoisotopic Mass | 378.06906321 g/mol |
| Topological Polar Surface Area | 31Ų |
| Heavy Atom Count | 26 |
| Formal Charge | 0 |
| Complexity | 440 |
Please kindly note that our products and services are for research use only.