| Catalog | OFC309886-5 |
| CAS | 309-88-6 |
| Category | Nucleophilic Fluorination Agents |
| Synonyms | Hexafluoropropene Diethylamine; N,N-Diethyl-1,1,2,3,3,3-hexafluoropropylamine |
| Purity | >92.0%(T) |
| MDL Number | MFCD00060264 |
※ Please kindly note that our products are for research use only.
| IUPAC Name | N,N-diethyl-1,1,2,3,3,3-hexafluoropropan-1-amine |
| InChI | InChI=1S/C7H11F6N/c1-3-14(4-2)7(12,13)5(8)6(9,10)11/h5H,3-4H2,1-2H3 |
| InChI Key | BNTFCVMJHBNJAR-UHFFFAOYSA-N |
| Isomeric SMILES | CCN(CC)C(C(C(F)(F)F)F)(F)F |
| EC Number | 628-698-8 |
| Reaxys Registry Number | 7833073 |
| Molecular Formula | C7H11F6N |
| Molecular Weight | 223.16 |
| Boiling Point | 54 °C (50 mmHg) |
| Flash Point | 40 °C |
| Appearance | Colorless to yellow clear liquid |
| Solubility | Soluble in ether, acetone |
| Storage | Store under inert gas |
| Stability | Moisture sensitive |
| XLogP3-AA | 3.3 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 7 |
| Rotatable Bond Count | 4 |
| Exact Mass | 223.07956833 g/mol |
| Monoisotopic Mass | 223.07956833 g/mol |
| Topological Polar Surface Area | 3.2Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 174 |
| HS Number | 2903.39.2050 |
Please kindly note that our products and services are for research use only.