| Catalog | OFC1092775615 | 
| CAS | 1092775-61-5 | 
| Category | Fluorinated Catalysts | 
| Synonyms | Iridium(1+), (2,2'-bipyridine-κN1,κN1')bis[3,5-difluoro-2-[5-(trifluoromethyl)-2-pyridinyl-κN]phenyl-κC]-, (OC-6-33)- | 
| MDL Number | MFCD28987331 | 
※ Please kindly note that our products are for research use only.
| IUPAC Name | 2-(2,4-difluorobenzene-6-id-1-yl)-5-(trifluoromethyl)pyridine;iridium(3+);2-pyridin-2-ylpyridine;hexafluorophosphate | 
| InChI | InChI=1S/2C12H12F5N.C10H12N2.F6P.Ir/c2*13-8-2-3-9(10(14)5-8)11-4-1-7(6-18-11)12(15,16)17;1-3-7-11-9(5-1)10-6-2-4-8-12-10;1 | 
| InChI Key | FINGSNSDPWKYLB-YQVPYEJZSA-N | 
| Isomeric SMILES | C1=CC=NC(=C1)C2=CC=CC=N2.C1=CC(=NC=C1C(F)(F)F)C2=C(C=C(C=[C-]2)F)F.C1=CC(=NC=C1C(F)(F)F)C2=C(C=C(C=[C-]2)F)F.F[P-](F)(F)(F)(F)F.[Ir+3] | 
| Canonical SMILES | FP(F)(F)(F)(F)F.FC1=CC(F)[C@@H]2[C@H](C1)[Ir]13([C@H]4CC(=C[C@H](C4C4=CC[C@H](CN14)C(F)(F)F)F)F)([N]1=CC=CC[C@H]1C1=CCCC=[N]31)N1C2=CC[C@H](C1)C(F)(F)F | 
| Molecular Formula | C34H36F16IrN4P | 
| Molecular Weight | 1027.84 | 
| Melting Point | >300 °C | 
| Appearance | Yellow crystalline solid or powder | 
| Hydrogen Bond Donor Count | 0 | 
| Hydrogen Bond Acceptor Count | 23 | 
| Rotatable Bond Count | 3 | 
| Exact Mass | 1027.8534 | 
| Monoisotopic Mass | 1027.8534 | 
| Topological Polar Surface Area | 51.6Ų | 
| Heavy Atom Count | 56 | 
| Formal Charge | 0 | 
| Complexity | 1110 | 
Please kindly note that our products and services are for research use only.